C14H16N6O8S3 — CID 131716157
(6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl]amino]-3-methylsulfonyloxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 131716157) has the molecular formula C14H16N6O8S3 and a molecular weight of 492.52 g/mol. Its IUPAC name is (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl]amino]-3-methylsulfonyloxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl]amino]-3-methylsulfonyloxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 131716157 |
| Molecular Formula | C14H16N6O8S3 |
| Molecular Weight | 492.52 g/mol |
| Exact Mass | 492.02 |
| IUPAC Name | (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl]amino]-3-methylsulfonyloxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(OS(C)(=O)=O)CS[C@H]12)c1nsc(N)n1 |
| InChI | InChI=1S/C14H16N6O8S3/c1-3-27-18-6(9-17-14(15)30-19-9)10(21)16-7-11(22)20-8(13(23)24)5(4-29-12(7)20)28-31(2,25)26/h7,12H,3-4H2,1-2H3,(H,16,21)(H,23,24)(H2,15,17,19)/t7?,12-/m1/s1 |
| InChIKey | GUSNABNKICBPBP-RKSKCOGQSA-N |
| XLogP | -1.47 |
| TPSA | 203.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.52 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|