C14H16ClN7O5S2 — CID 88678590
(6R)-7-[[(2E)-2-(3-aminopropoxyimino)-2-(5-amino-1,2,4-thiadiazol-3-yl)acetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88678590) has the molecular formula C14H16ClN7O5S2 and a molecular weight of 461.91 g/mol. Its IUPAC name is (6R)-7-[[(2E)-2-(3-aminopropoxyimino)-2-(5-amino-1,2,4-thiadiazol-3-yl)acetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[[(2E)-2-(3-aminopropoxyimino)-2-(5-amino-1,2,4-thiadiazol-3-yl)acetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88678590 |
| Molecular Formula | C14H16ClN7O5S2 |
| Molecular Weight | 461.91 g/mol |
| Exact Mass | 461.03 |
| IUPAC Name | (6R)-7-[[(2E)-2-(3-aminopropoxyimino)-2-(5-amino-1,2,4-thiadiazol-3-yl)acetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | NCCCO/N=C(/C(=O)NC1C(=O)N2C(C(=O)O)=C(Cl)CS[C@H]12)c1nsc(N)n1 |
| InChI | InChI=1S/C14H16ClN7O5S2/c15-5-4-28-12-7(11(24)22(12)8(5)13(25)26)18-10(23)6(20-27-3-1-2-16)9-19-14(17)29-21-9/h7,12H,1-4,16H2,(H,18,23)(H,25,26)(H2,17,19,21)/b20-6+/t7?,12-/m1/s1 |
| InChIKey | FMNWHQIIAWLYQL-LOKWMOTJSA-N |
| XLogP | -0.88 |
| TPSA | 186.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.91 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|