C16H18ClN5O5S2 — CID 131712491
(6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-butoxyiminoacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 131712491) has the molecular formula C16H18ClN5O5S2 and a molecular weight of 459.94 g/mol. Its IUPAC name is (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-butoxyiminoacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-butoxyiminoacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 131712491 |
| Molecular Formula | C16H18ClN5O5S2 |
| Molecular Weight | 459.94 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-butoxyiminoacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCCCON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(Cl)CS[C@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C16H18ClN5O5S2/c1-2-3-4-27-21-9(8-6-29-16(18)19-8)12(23)20-10-13(24)22-11(15(25)26)7(17)5-28-14(10)22/h6,10,14H,2-5H2,1H3,(H2,18,19)(H,20,23)(H,25,26)/t10?,14-/m1/s1 |
| InChIKey | RNDYODVBUVPBSF-LNUXAPHWSA-N |
| XLogP | 1.18 |
| TPSA | 147.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.94 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|