C30H26N6O7S2 — CID 173358686
benzhydryl (6R)-3-(2-amino-3,4-dioxocyclobuten-1-yl)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 173358686) has the molecular formula C30H26N6O7S2 and a molecular weight of 646.71 g/mol. Its IUPAC name is benzhydryl (6R)-3-(2-amino-3,4-dioxocyclobuten-1-yl)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | benzhydryl (6R)-3-(2-amino-3,4-dioxocyclobuten-1-yl)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 173358686 |
| Molecular Formula | C30H26N6O7S2 |
| Molecular Weight | 646.71 g/mol |
| Exact Mass | 646.13 |
| IUPAC Name | benzhydryl (6R)-3-(2-amino-3,4-dioxocyclobuten-1-yl)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | CON=C(C(=O)NC1C(=O)N2CC(C(=O)OC(c3ccccc3)c3ccccc3)(c3c(N)c(=O)c3=O)CS[C@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C30H26N6O7S2/c1-42-35-20(17-12-44-29(32)33-17)25(39)34-21-26(40)36-13-30(14-45-27(21)36,18-19(31)23(38)22(18)37)28(41)43-24(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-12,21,24,27H,13-14,31H2,1H3,(H2,32,33)(H,34,39)/t21?,27-,30?/m1/s1 |
| InChIKey | MTALPLWYWKTXAQ-CSLSLHETSA-N |
| XLogP | 0.92 |
| TPSA | 196.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.71 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|