C20H27N5O9S2 — CID 173406550
1-ethoxycarbonyloxyethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 173406550) has the molecular formula C20H27N5O9S2 and a molecular weight of 545.60 g/mol. Its IUPAC name is 1-ethoxycarbonyloxyethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | 1-ethoxycarbonyloxyethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 173406550 |
| Molecular Formula | C20H27N5O9S2 |
| Molecular Weight | 545.60 g/mol |
| Exact Mass | 545.13 |
| IUPAC Name | 1-ethoxycarbonyloxyethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | CCOC(=O)OC(C)OC(=O)C1(COC)CS[C@@H]2C(NC(=O)C(=NOC)c3csc(N)n3)C(=O)N2C1 |
| InChI | InChI=1S/C20H27N5O9S2/c1-5-32-19(29)34-10(2)33-17(28)20(8-30-3)7-25-15(27)13(16(25)36-9-20)23-14(26)12(24-31-4)11-6-35-18(21)22-11/h6,10,13,16H,5,7-9H2,1-4H3,(H2,21,22)(H,23,26)/t10?,13?,16-,20?/m1/s1 |
| InChIKey | GIQRKWMUTOGXGP-NOZXZAHVSA-N |
| XLogP | 0.17 |
| TPSA | 180.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.60 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|