C18H23N5O9S2 — CID 173421099
1-methoxycarbonyloxyethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 173421099) has the molecular formula C18H23N5O9S2 and a molecular weight of 517.54 g/mol. Its IUPAC name is 1-methoxycarbonyloxyethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | 1-methoxycarbonyloxyethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 173421099 |
| Molecular Formula | C18H23N5O9S2 |
| Molecular Weight | 517.54 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | 1-methoxycarbonyloxyethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | COCC1(C(=O)OC(C)OC(=O)OC)CS[C@@H]2C(NC(=O)C(=NO)c3csc(N)n3)C(=O)N2C1 |
| InChI | InChI=1S/C18H23N5O9S2/c1-8(32-17(27)30-3)31-15(26)18(6-29-2)5-23-13(25)11(14(23)34-7-18)21-12(24)10(22-28)9-4-33-16(19)20-9/h4,8,11,14,28H,5-7H2,1-3H3,(H2,19,20)(H,21,24)/t8?,11?,14-,18?/m1/s1 |
| InChIKey | GVSQNOLOTKAKPS-XTRMVZGCSA-N |
| XLogP | -0.39 |
| TPSA | 191.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.54 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|