C19H25N5O9S2 — CID 173406530
ethoxycarbonyloxymethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 173406530) has the molecular formula C19H25N5O9S2 and a molecular weight of 531.57 g/mol. Its IUPAC name is ethoxycarbonyloxymethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | ethoxycarbonyloxymethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 173406530 |
| Molecular Formula | C19H25N5O9S2 |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.11 |
| IUPAC Name | ethoxycarbonyloxymethyl (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | CCOC(=O)OCOC(=O)C1(COC)CS[C@@H]2C(NC(=O)C(=NOC)c3csc(N)n3)C(=O)N2C1 |
| InChI | InChI=1S/C19H25N5O9S2/c1-4-31-18(28)33-9-32-16(27)19(7-29-2)6-24-14(26)12(15(24)35-8-19)22-13(25)11(23-30-3)10-5-34-17(20)21-10/h5,12,15H,4,6-9H2,1-3H3,(H2,20,21)(H,22,25)/t12?,15-,19?/m1/s1 |
| InChIKey | CCLXKGGALAZCLO-WXYZLBAPSA-N |
| XLogP | -0.22 |
| TPSA | 180.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|