C17H15N5O8S2 — CID 173358699
(6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(2-hydroxy-3,4-dioxocyclobuten-1-yl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 173358699) has the molecular formula C17H15N5O8S2 and a molecular weight of 481.47 g/mol. Its IUPAC name is (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(2-hydroxy-3,4-dioxocyclobuten-1-yl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(2-hydroxy-3,4-dioxocyclobuten-1-yl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 173358699 |
| Molecular Formula | C17H15N5O8S2 |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 481.04 |
| IUPAC Name | (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-(2-hydroxy-3,4-dioxocyclobuten-1-yl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | CON=C(C(=O)NC1C(=O)N2CC(C(=O)O)(c3c(O)c(=O)c3=O)CS[C@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C17H15N5O8S2/c1-30-21-7(5-2-31-16(18)19-5)12(26)20-8-13(27)22-3-17(15(28)29,4-32-14(8)22)6-9(23)11(25)10(6)24/h2,8,14,23H,3-4H2,1H3,(H2,18,19)(H,20,26)(H,28,29)/t8?,14-,17?/m1/s1 |
| InChIKey | GTNNIYULFZWNEI-LZMSQSBZSA-N |
| XLogP | -2.20 |
| TPSA | 201.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|