C15H18ClN5O5S2 — CID 173389614
(6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-propoxyiminoacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 173389614) has the molecular formula C15H18ClN5O5S2 and a molecular weight of 447.93 g/mol. Its IUPAC name is (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-propoxyiminoacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-propoxyiminoacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 173389614 |
| Molecular Formula | C15H18ClN5O5S2 |
| Molecular Weight | 447.93 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-propoxyiminoacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | CCCON=C(C(=O)NC1C(=O)N2CC(Cl)(C(=O)O)CS[C@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C15H18ClN5O5S2/c1-2-3-26-20-8(7-4-27-14(17)18-7)10(22)19-9-11(23)21-5-15(16,13(24)25)6-28-12(9)21/h4,9,12H,2-3,5-6H2,1H3,(H2,17,18)(H,19,22)(H,24,25)/t9?,12-,15?/m1/s1 |
| InChIKey | QKTHOBQVUPLFIX-YAKODHLKSA-N |
| XLogP | 0.32 |
| TPSA | 147.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.93 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|