C18H22ClN5O7S2 — CID 173418547
(6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]iminoacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 173418547) has the molecular formula C18H22ClN5O7S2 and a molecular weight of 519.99 g/mol. Its IUPAC name is (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]iminoacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]iminoacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 173418547 |
| Molecular Formula | C18H22ClN5O7S2 |
| Molecular Weight | 519.99 g/mol |
| Exact Mass | 519.06 |
| IUPAC Name | (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]iminoacetyl]amino]-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)CON=C(C(=O)NC1C(=O)N2CC(Cl)(C(=O)O)CS[C@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C18H22ClN5O7S2/c1-17(2,3)31-9(25)4-30-23-10(8-5-32-16(20)21-8)12(26)22-11-13(27)24-6-18(19,15(28)29)7-33-14(11)24/h5,11,14H,4,6-7H2,1-3H3,(H2,20,21)(H,22,26)(H,28,29)/t11?,14-,18?/m1/s1 |
| InChIKey | YQOOZKMMVRDMIS-NDBLMLTRSA-N |
| XLogP | 0.25 |
| TPSA | 173.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.99 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|