C34H30N6O6S3 — CID 173413441
benzhydryl (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(2-pyridin-3-ylsulfanylethenyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 173413441) has the molecular formula C34H30N6O6S3 and a molecular weight of 714.85 g/mol. Its IUPAC name is benzhydryl (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(2-pyridin-3-ylsulfanylethenyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | benzhydryl (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(2-pyridin-3-ylsulfanylethenyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 173413441 |
| Molecular Formula | C34H30N6O6S3 |
| Molecular Weight | 714.85 g/mol |
| Exact Mass | 714.14 |
| IUPAC Name | benzhydryl (6R)-7-[[2-(2-formamido-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(2-pyridin-3-ylsulfanylethenyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | CON=C(C(=O)NC1C(=O)N2CC(C=CSc3cccnc3)(C(=O)OC(c3ccccc3)c3ccccc3)CS[C@H]12)c1csc(NC=O)n1 |
| InChI | InChI=1S/C34H30N6O6S3/c1-45-39-26(25-18-48-33(37-25)36-21-41)29(42)38-27-30(43)40-19-34(20-49-31(27)40,14-16-47-24-13-8-15-35-17-24)32(44)46-28(22-9-4-2-5-10-22)23-11-6-3-7-12-23/h2-18,21,27-28,31H,19-20H2,1H3,(H,38,42)(H,36,37,41)/t27?,31-,34?/m1/s1 |
| InChIKey | XTRUJFZSOVXVKU-SYPKMICISA-N |
| XLogP | 4.48 |
| TPSA | 152.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.85 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|