C30H29N5O8S3 — CID 173328053
(6R)-7-[[2-(2-benzhydryloxy-2-oxoethoxy)imino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-3-(methylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 173328053) has the molecular formula C30H29N5O8S3 and a molecular weight of 683.79 g/mol. Its IUPAC name is (6R)-7-[[2-(2-benzhydryloxy-2-oxoethoxy)imino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-3-(methylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-7-[[2-(2-benzhydryloxy-2-oxoethoxy)imino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-3-(methylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 173328053 |
| Molecular Formula | C30H29N5O8S3 |
| Molecular Weight | 683.79 g/mol |
| Exact Mass | 683.12 |
| IUPAC Name | (6R)-7-[[2-(2-benzhydryloxy-2-oxoethoxy)imino-2-(2-formamido-1,3-thiazol-4-yl)acetyl]amino]-3-(methylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | CSCC1(C(=O)O)CS[C@@H]2C(NC(=O)C(=NOCC(=O)OC(c3ccccc3)c3ccccc3)c3csc(NC=O)n3)C(=O)N2C1 |
| InChI | InChI=1S/C30H29N5O8S3/c1-44-15-30(28(40)41)14-35-26(39)23(27(35)46-16-30)33-25(38)22(20-13-45-29(32-20)31-17-36)34-42-12-21(37)43-24(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-11,13,17,23-24,27H,12,14-16H2,1H3,(H,33,38)(H,40,41)(H,31,32,36)/t23?,27-,30?/m1/s1 |
| InChIKey | CDCBXDRQZBWHSP-DLPZQXBVSA-N |
| XLogP | 2.60 |
| TPSA | 176.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.79 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|