C14H16N6O6S — CID 173359400
(6R)-7-[[2-(5-amino-1,2,4-oxadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 173359400) has the molecular formula C14H16N6O6S and a molecular weight of 396.39 g/mol. Its IUPAC name is (6R)-7-[[2-(5-amino-1,2,4-oxadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-7-[[2-(5-amino-1,2,4-oxadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 173359400 |
| Molecular Formula | C14H16N6O6S |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | (6R)-7-[[2-(5-amino-1,2,4-oxadiazol-3-yl)-2-methoxyiminoacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | C=CC1(C(=O)O)CS[C@@H]2C(NC(=O)C(=NOC)c3noc(N)n3)C(=O)N2C1 |
| InChI | InChI=1S/C14H16N6O6S/c1-3-14(12(23)24)4-20-10(22)7(11(20)27-5-14)16-9(21)6(18-25-2)8-17-13(15)26-19-8/h3,7,11H,1,4-5H2,2H3,(H,16,21)(H,23,24)(H2,15,17,19)/t7?,11-,14?/m1/s1 |
| InChIKey | QERFUGNPCBFKKI-MIJJTYSQSA-N |
| XLogP | -1.34 |
| TPSA | 173.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|