C13H15N5O5S2 — CID 173420686
(6R)-7-[[2-methoxyimino-2-(thiadiazol-4-yl)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 173420686) has the molecular formula C13H15N5O5S2 and a molecular weight of 385.43 g/mol. Its IUPAC name is (6R)-7-[[2-methoxyimino-2-(thiadiazol-4-yl)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-7-[[2-methoxyimino-2-(thiadiazol-4-yl)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 173420686 |
| Molecular Formula | C13H15N5O5S2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | (6R)-7-[[2-methoxyimino-2-(thiadiazol-4-yl)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | CON=C(C(=O)NC1C(=O)N2CC(C)(C(=O)O)CS[C@H]12)c1csnn1 |
| InChI | InChI=1S/C13H15N5O5S2/c1-13(12(21)22)4-18-10(20)8(11(18)24-5-13)14-9(19)7(16-23-2)6-3-25-17-15-6/h3,8,11H,4-5H2,1-2H3,(H,14,19)(H,21,22)/t8?,11-,13?/m1/s1 |
| InChIKey | GKGSDNQBOQWFCC-UHLWVNKISA-N |
| XLogP | -0.62 |
| TPSA | 134.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|