C12H11N5O5S2 — CID 12775103
(6R)-7-[[(2Z)-2-methoxyimino-2-(thiadiazol-4-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 12775103) has the molecular formula C12H11N5O5S2 and a molecular weight of 369.38 g/mol. Its IUPAC name is (6R)-7-[[(2Z)-2-methoxyimino-2-(thiadiazol-4-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[[(2Z)-2-methoxyimino-2-(thiadiazol-4-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 12775103 |
| Molecular Formula | C12H11N5O5S2 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | (6R)-7-[[(2Z)-2-methoxyimino-2-(thiadiazol-4-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CO/N=C(\C(=O)NC1C(=O)N2C(C(=O)O)=CCS[C@H]12)c1csnn1 |
| InChI | InChI=1S/C12H11N5O5S2/c1-22-15-7(5-4-24-16-14-5)9(18)13-8-10(19)17-6(12(20)21)2-3-23-11(8)17/h2,4,8,11H,3H2,1H3,(H,13,18)(H,20,21)/b15-7-/t8?,11-/m1/s1 |
| InChIKey | VOZXYFWLFGQTDB-KSYZOYIJSA-N |
| XLogP | -0.74 |
| TPSA | 134.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|