C19H25N7O6S2 — CID 10816437
(6R,7R)-7-[[(2Z)-2-[2-[[(2S)-2,6-diaminohexanoyl]amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 10816437) has the molecular formula C19H25N7O6S2 and a molecular weight of 511.59 g/mol. Its IUPAC name is (6R,7R)-7-[[(2Z)-2-[2-[[(2S)-2,6-diaminohexanoyl]amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-7-[[(2Z)-2-[2-[[(2S)-2,6-diaminohexanoyl]amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 10816437 |
| Molecular Formula | C19H25N7O6S2 |
| Molecular Weight | 511.59 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | (6R,7R)-7-[[(2Z)-2-[2-[[(2S)-2,6-diaminohexanoyl]amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CO/N=C(\C(=O)N[C@@H]1C(=O)N2C(C(=O)O)=CCS[C@H]12)c1csc(NC(=O)[C@@H](N)CCCCN)n1 |
| InChI | InChI=1S/C19H25N7O6S2/c1-32-25-12(10-8-34-19(22-10)24-14(27)9(21)4-2-3-6-20)15(28)23-13-16(29)26-11(18(30)31)5-7-33-17(13)26/h5,8-9,13,17H,2-4,6-7,20-21H2,1H3,(H,23,28)(H,30,31)(H,22,24,27)/b25-12-/t9-,13+,17+/m0/s1 |
| InChIKey | JBHILWGVOBJULM-OBZSRRSWSA-N |
| XLogP | -0.74 |
| TPSA | 202.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.59 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|