C14H13N3O6S — CID 88747307
(6R,7R)-7-[[(2Z)-2-(furan-2-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88747307) has the molecular formula C14H13N3O6S and a molecular weight of 351.34 g/mol. Its IUPAC name is (6R,7R)-7-[[(2Z)-2-(furan-2-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-7-[[(2Z)-2-(furan-2-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88747307 |
| Molecular Formula | C14H13N3O6S |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | (6R,7R)-7-[[(2Z)-2-(furan-2-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CO/N=C(\C(=O)N[C@@H]1C(=O)N2C(C(=O)O)=CCS[C@H]12)c1ccco1 |
| InChI | InChI=1S/C14H13N3O6S/c1-22-16-9(8-3-2-5-23-8)11(18)15-10-12(19)17-7(14(20)21)4-6-24-13(10)17/h2-5,10,13H,6H2,1H3,(H,15,18)(H,20,21)/b16-9-/t10-,13-/m1/s1 |
| InChIKey | ZLEFZTUTNYSJIU-DXVYGPEISA-N |
| XLogP | -0.00 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|