C12H14BrN3O6S — CID 173389336
(6R)-7-[(4-bromo-3-hydroxy-2-nitrosobut-2-enoyl)amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 173389336) has the molecular formula C12H14BrN3O6S and a molecular weight of 408.23 g/mol. Its IUPAC name is (6R)-7-[(4-bromo-3-hydroxy-2-nitrosobut-2-enoyl)amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-7-[(4-bromo-3-hydroxy-2-nitrosobut-2-enoyl)amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 173389336 |
| Molecular Formula | C12H14BrN3O6S |
| Molecular Weight | 408.23 g/mol |
| Exact Mass | 406.98 |
| IUPAC Name | (6R)-7-[(4-bromo-3-hydroxy-2-nitrosobut-2-enoyl)amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | CC1(C(=O)O)CS[C@@H]2C(NC(=O)C(N=O)=C(O)CBr)C(=O)N2C1 |
| InChI | InChI=1S/C12H14BrN3O6S/c1-12(11(20)21)3-16-9(19)7(10(16)23-4-12)14-8(18)6(15-22)5(17)2-13/h7,10,17H,2-4H2,1H3,(H,14,18)(H,20,21)/t7?,10-,12?/m1/s1 |
| InChIKey | VNPVIMXNOFARDV-VPHNTROTSA-N |
| XLogP | 0.41 |
| TPSA | 136.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.23 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|