C26H22BrN3O6S — CID 173395206
benzhydryl (6S)-7-[(4-bromo-3-hydroxy-2-nitrosobut-2-enoyl)amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 173395206) has the molecular formula C26H22BrN3O6S and a molecular weight of 584.45 g/mol. Its IUPAC name is benzhydryl (6S)-7-[(4-bromo-3-hydroxy-2-nitrosobut-2-enoyl)amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6S)-7-[(4-bromo-3-hydroxy-2-nitrosobut-2-enoyl)amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 173395206 |
| Molecular Formula | C26H22BrN3O6S |
| Molecular Weight | 584.45 g/mol |
| Exact Mass | 583.04 |
| IUPAC Name | benzhydryl (6S)-7-[(4-bromo-3-hydroxy-2-nitrosobut-2-enoyl)amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | C=CC1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)C(NC(=O)C(N=O)=C(O)CBr)[C@@H]2SC1 |
| InChI | InChI=1S/C26H22BrN3O6S/c1-2-15-14-37-25-20(28-23(32)19(29-35)18(31)13-27)24(33)30(25)21(15)26(34)36-22(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h2-12,20,22,25,31H,1,13-14H2,(H,28,32)/t20?,25-/m0/s1 |
| InChIKey | DAPGKQULMDKPIL-KUXBLMNESA-N |
| XLogP | 4.09 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|