C32H25Cl2N3O6S — CID 88783882
benzhydryl (6S,7R)-7-[[2-(2,2-dichloroacetyl)oxyimino-2-phenylacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88783882) has the molecular formula C32H25Cl2N3O6S and a molecular weight of 650.54 g/mol. Its IUPAC name is benzhydryl (6S,7R)-7-[[2-(2,2-dichloroacetyl)oxyimino-2-phenylacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6S,7R)-7-[[2-(2,2-dichloroacetyl)oxyimino-2-phenylacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88783882 |
| Molecular Formula | C32H25Cl2N3O6S |
| Molecular Weight | 650.54 g/mol |
| Exact Mass | 649.08 |
| IUPAC Name | benzhydryl (6S,7R)-7-[[2-(2,2-dichloroacetyl)oxyimino-2-phenylacetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | C=CC1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)[C@@H](NC(=O)C(=NOC(=O)C(Cl)Cl)c3ccccc3)[C@@H]2SC1 |
| InChI | InChI=1S/C32H25Cl2N3O6S/c1-2-19-18-44-30-24(35-28(38)23(20-12-6-3-7-13-20)36-43-32(41)27(33)34)29(39)37(30)25(19)31(40)42-26(21-14-8-4-9-15-21)22-16-10-5-11-17-22/h2-17,24,26-27,30H,1,18H2,(H,35,38)/t24-,30+/m1/s1 |
| InChIKey | NKAXWVBHYFVVLT-HLADLETHSA-N |
| XLogP | 4.91 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|