C45H37N5O4S2 — CID 67859902
benzhydryl (6R)-3-ethenyl-8-oxo-7-[[2-[5-(tritylamino)-1,2,4-thiadiazol-3-yl]acetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 67859902) has the molecular formula C45H37N5O4S2 and a molecular weight of 775.96 g/mol. Its IUPAC name is benzhydryl (6R)-3-ethenyl-8-oxo-7-[[2-[5-(tritylamino)-1,2,4-thiadiazol-3-yl]acetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R)-3-ethenyl-8-oxo-7-[[2-[5-(tritylamino)-1,2,4-thiadiazol-3-yl]acetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 67859902 |
| Molecular Formula | C45H37N5O4S2 |
| Molecular Weight | 775.96 g/mol |
| Exact Mass | 775.23 |
| IUPAC Name | benzhydryl (6R)-3-ethenyl-8-oxo-7-[[2-[5-(tritylamino)-1,2,4-thiadiazol-3-yl]acetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | C=CC1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)C(NC(=O)Cc3nsc(NC(c4ccccc4)(c4ccccc4)c4ccccc4)n3)[C@H]2SC1 |
| InChI | InChI=1S/C45H37N5O4S2/c1-2-30-29-55-42-38(41(52)50(42)39(30)43(53)54-40(31-18-8-3-9-19-31)32-20-10-4-11-21-32)47-37(51)28-36-46-44(56-49-36)48-45(33-22-12-5-13-23-33,34-24-14-6-15-25-34)35-26-16-7-17-27-35/h2-27,38,40,42H,1,28-29H2,(H,47,51)(H,46,48,49)/t38?,42-/m1/s1 |
| InChIKey | PNFANIGLIYYHQO-HZTHSXHVSA-N |
| XLogP | 7.66 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.96 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|