C27H24BrN3O6S — CID 131713160
benzhydryl (6R)-7-[(4-bromo-2-methoxyimino-3-oxobutanoyl)amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 131713160) has the molecular formula C27H24BrN3O6S and a molecular weight of 598.48 g/mol. Its IUPAC name is benzhydryl (6R)-7-[(4-bromo-2-methoxyimino-3-oxobutanoyl)amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R)-7-[(4-bromo-2-methoxyimino-3-oxobutanoyl)amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 131713160 |
| Molecular Formula | C27H24BrN3O6S |
| Molecular Weight | 598.48 g/mol |
| Exact Mass | 597.06 |
| IUPAC Name | benzhydryl (6R)-7-[(4-bromo-2-methoxyimino-3-oxobutanoyl)amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | C=CC1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)C(NC(=O)C(=NOC)C(=O)CBr)[C@H]2SC1 |
| InChI | InChI=1S/C27H24BrN3O6S/c1-3-16-15-38-26-21(29-24(33)20(30-36-2)19(32)14-28)25(34)31(26)22(16)27(35)37-23(17-10-6-4-7-11-17)18-12-8-5-9-13-18/h3-13,21,23,26H,1,14-15H2,2H3,(H,29,33)/t21?,26-/m1/s1 |
| InChIKey | VTLOWXSMVHNAHE-ZTDHTWSHSA-N |
| XLogP | 3.13 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|