C35H30BrN3O8S — CID 131713331
benzhydryl (6R)-7-[[4-bromo-3-oxo-2-(2-oxo-2-phenylmethoxyethoxy)iminobutanoyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 131713331) has the molecular formula C35H30BrN3O8S and a molecular weight of 732.61 g/mol. Its IUPAC name is benzhydryl (6R)-7-[[4-bromo-3-oxo-2-(2-oxo-2-phenylmethoxyethoxy)iminobutanoyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R)-7-[[4-bromo-3-oxo-2-(2-oxo-2-phenylmethoxyethoxy)iminobutanoyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 131713331 |
| Molecular Formula | C35H30BrN3O8S |
| Molecular Weight | 732.61 g/mol |
| Exact Mass | 731.09 |
| IUPAC Name | benzhydryl (6R)-7-[[4-bromo-3-oxo-2-(2-oxo-2-phenylmethoxyethoxy)iminobutanoyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | C=CC1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)C(NC(=O)C(=NOCC(=O)OCc3ccccc3)C(=O)CBr)[C@H]2SC1 |
| InChI | InChI=1S/C35H30BrN3O8S/c1-2-23-21-48-34-29(37-32(42)28(26(40)18-36)38-46-20-27(41)45-19-22-12-6-3-7-13-22)33(43)39(34)30(23)35(44)47-31(24-14-8-4-9-15-24)25-16-10-5-11-17-25/h2-17,29,31,34H,1,18-21H2,(H,37,42)/t29?,34-/m1/s1 |
| InChIKey | REWTVACDPTVIFX-VWERDZHISA-N |
| XLogP | 4.24 |
| TPSA | 140.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.61 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|