C17H15BrCl3N3O8S — CID 57057589
(6S)-7-[[4-bromo-3-oxo-2-[2-oxo-2-(2,2,2-trichloroethoxy)ethoxy]iminobutanoyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 57057589) has the molecular formula C17H15BrCl3N3O8S and a molecular weight of 607.65 g/mol. Its IUPAC name is (6S)-7-[[4-bromo-3-oxo-2-[2-oxo-2-(2,2,2-trichloroethoxy)ethoxy]iminobutanoyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-7-[[4-bromo-3-oxo-2-[2-oxo-2-(2,2,2-trichloroethoxy)ethoxy]iminobutanoyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 57057589 |
| Molecular Formula | C17H15BrCl3N3O8S |
| Molecular Weight | 607.65 g/mol |
| Exact Mass | 604.88 |
| IUPAC Name | (6S)-7-[[4-bromo-3-oxo-2-[2-oxo-2-(2,2,2-trichloroethoxy)ethoxy]iminobutanoyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | C=CC1=C(C(=O)O)N2C(=O)C(NC(=O)C(=NOCC(=O)OCC(Cl)(Cl)Cl)C(=O)CBr)[C@@H]2SC1 |
| InChI | InChI=1S/C17H15BrCl3N3O8S/c1-2-7-5-33-15-11(14(28)24(15)12(7)16(29)30)22-13(27)10(8(25)3-18)23-32-4-9(26)31-6-17(19,20)21/h2,11,15H,1,3-6H2,(H,22,27)(H,29,30)/t11?,15-/m0/s1 |
| InChIKey | IHRKKJNQAIUQSA-MHTVFEQDSA-N |
| XLogP | 1.16 |
| TPSA | 151.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.65 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|