C14H14BrN3O8S — CID 154410823
(6R)-3-acetyloxy-7-[(4-bromo-2-methoxyimino-3-oxobutanoyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 154410823) has the molecular formula C14H14BrN3O8S and a molecular weight of 464.25 g/mol. Its IUPAC name is (6R)-3-acetyloxy-7-[(4-bromo-2-methoxyimino-3-oxobutanoyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-3-acetyloxy-7-[(4-bromo-2-methoxyimino-3-oxobutanoyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 154410823 |
| Molecular Formula | C14H14BrN3O8S |
| Molecular Weight | 464.25 g/mol |
| Exact Mass | 462.97 |
| IUPAC Name | (6R)-3-acetyloxy-7-[(4-bromo-2-methoxyimino-3-oxobutanoyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CON=C(C(=O)CBr)C(=O)NC1C(=O)N2C(C(=O)O)=C(OC(C)=O)CS[C@H]12 |
| InChI | InChI=1S/C14H14BrN3O8S/c1-5(19)26-7-4-27-13-9(12(22)18(13)10(7)14(23)24)16-11(21)8(17-25-2)6(20)3-15/h9,13H,3-4H2,1-2H3,(H,16,21)(H,23,24)/t9?,13-/m1/s1 |
| InChIKey | ZYEXVGCNXMEIPA-WCRCJTMVSA-N |
| XLogP | -0.79 |
| TPSA | 151.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.25 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|