C15H19N3O10S2 — CID 131713963
(6R)-7-[[(2E)-2-methoxyimino-4-methylsulfonyloxy-3-oxobutanoyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 131713963) has the molecular formula C15H19N3O10S2 and a molecular weight of 465.46 g/mol. Its IUPAC name is (6R)-7-[[(2E)-2-methoxyimino-4-methylsulfonyloxy-3-oxobutanoyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[[(2E)-2-methoxyimino-4-methylsulfonyloxy-3-oxobutanoyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 131713963 |
| Molecular Formula | C15H19N3O10S2 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | (6R)-7-[[(2E)-2-methoxyimino-4-methylsulfonyloxy-3-oxobutanoyl]amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | COCC1=C(C(=O)O)N2C(=O)C(NC(=O)/C(=N/OC)C(=O)COS(C)(=O)=O)[C@H]2SC1 |
| InChI | InChI=1S/C15H19N3O10S2/c1-26-4-7-6-29-14-10(13(21)18(14)11(7)15(22)23)16-12(20)9(17-27-2)8(19)5-28-30(3,24)25/h10,14H,4-6H2,1-3H3,(H,16,20)(H,22,23)/b17-9+/t10?,14-/m1/s1 |
| InChIKey | BYYZQJRMXBLSFI-OGTHEXOISA-N |
| XLogP | -2.08 |
| TPSA | 177.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|