C16H14N4O7S2 — CID 131714211
(6R)-7-[[2-(carboxymethoxyimino)-2-(1,3-thiazol-4-yl)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 131714211) has the molecular formula C16H14N4O7S2 and a molecular weight of 438.44 g/mol. Its IUPAC name is (6R)-7-[[2-(carboxymethoxyimino)-2-(1,3-thiazol-4-yl)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[[2-(carboxymethoxyimino)-2-(1,3-thiazol-4-yl)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 131714211 |
| Molecular Formula | C16H14N4O7S2 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.03 |
| IUPAC Name | (6R)-7-[[2-(carboxymethoxyimino)-2-(1,3-thiazol-4-yl)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | C=CC1=C(C(=O)O)N2C(=O)C(NC(=O)C(=NOCC(=O)O)c3cscn3)[C@H]2SC1 |
| InChI | InChI=1S/C16H14N4O7S2/c1-2-7-4-29-15-11(14(24)20(15)12(7)16(25)26)18-13(23)10(8-5-28-6-17-8)19-27-3-9(21)22/h2,5-6,11,15H,1,3-4H2,(H,18,23)(H,21,22)(H,25,26)/t11?,15-/m1/s1 |
| InChIKey | AJIOFGHUKPCKEH-JOPIAHFSSA-N |
| XLogP | -0.13 |
| TPSA | 158.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|