C15H14N4O7S2 — CID 14182820
7-[[(2E)-2-(carboxymethoxyimino)-2-(1,3-thiazol-4-yl)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 14182820) has the molecular formula C15H14N4O7S2 and a molecular weight of 426.43 g/mol. Its IUPAC name is 7-[[(2E)-2-(carboxymethoxyimino)-2-(1,3-thiazol-4-yl)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | 7-[[(2E)-2-(carboxymethoxyimino)-2-(1,3-thiazol-4-yl)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 14182820 |
| Molecular Formula | C15H14N4O7S2 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | 7-[[(2E)-2-(carboxymethoxyimino)-2-(1,3-thiazol-4-yl)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CC1=C(C(=O)O)N2C(=O)C(NC(=O)/C(=N/OCC(=O)O)c3cscn3)C2SC1 |
| InChI | InChI=1S/C15H14N4O7S2/c1-6-3-28-14-10(13(23)19(14)11(6)15(24)25)17-12(22)9(7-4-27-5-16-7)18-26-2-8(20)21/h4-5,10,14H,2-3H2,1H3,(H,17,22)(H,20,21)(H,24,25)/b18-9+ |
| InChIKey | VAEDZBPIXOZIPB-GIJQJNRQSA-N |
| XLogP | -0.29 |
| TPSA | 158.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|