C19H21N4O6S3- — CID 131713535
(6R)-3-methyl-7-[[2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]imino-2-(1,3-thiazol-4-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate (PubChem CID 131713535) has the molecular formula C19H21N4O6S3- and a molecular weight of 497.60 g/mol. Its IUPAC name is (6R)-3-methyl-7-[[2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]imino-2-(1,3-thiazol-4-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate.
| Compound Name | (6R)-3-methyl-7-[[2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]imino-2-(1,3-thiazol-4-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate |
|---|---|
| PubChem CID | 131713535 |
| Molecular Formula | C19H21N4O6S3- |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.06 |
| IUPAC Name | (6R)-3-methyl-7-[[2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]imino-2-(1,3-thiazol-4-yl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carbothioate |
| SMILES | CC1=C(C(=O)[S-])N2C(=O)C(NC(=O)C(=NOCC(=O)OC(C)(C)C)c3cscn3)[C@H]2SC1 |
| InChI | InChI=1S/C19H22N4O6S3/c1-9-6-32-17-13(16(26)23(17)14(9)18(27)30)21-15(25)12(10-7-31-8-20-10)22-28-5-11(24)29-19(2,3)4/h7-8,13,17H,5-6H2,1-4H3,(H,21,25)(H,27,30)/p-1/t13?,17-/m1/s1 |
| InChIKey | KONHIXTUZSXKKK-LRHAYUFXSA-M |
| XLogP | 0.95 |
| TPSA | 127.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|