C32H27Cl2N3O6S2 — CID 88784007
benzhydryl (6R,7R)-7-[[(2E)-2-(2,2-dichloroacetyl)oxyimino-2-phenylacetyl]amino]-3-(methylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88784007) has the molecular formula C32H27Cl2N3O6S2 and a molecular weight of 684.62 g/mol. Its IUPAC name is benzhydryl (6R,7R)-7-[[(2E)-2-(2,2-dichloroacetyl)oxyimino-2-phenylacetyl]amino]-3-(methylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R,7R)-7-[[(2E)-2-(2,2-dichloroacetyl)oxyimino-2-phenylacetyl]amino]-3-(methylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88784007 |
| Molecular Formula | C32H27Cl2N3O6S2 |
| Molecular Weight | 684.62 g/mol |
| Exact Mass | 683.07 |
| IUPAC Name | benzhydryl (6R,7R)-7-[[(2E)-2-(2,2-dichloroacetyl)oxyimino-2-phenylacetyl]amino]-3-(methylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CSCC1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)[C@@H](NC(=O)/C(=N/OC(=O)C(Cl)Cl)c3ccccc3)[C@H]2SC1 |
| InChI | InChI=1S/C32H27Cl2N3O6S2/c1-44-17-22-18-45-30-24(35-28(38)23(19-11-5-2-6-12-19)36-43-32(41)27(33)34)29(39)37(30)25(22)31(40)42-26(20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-16,24,26-27,30H,17-18H2,1H3,(H,35,38)/b36-23+/t24-,30-/m1/s1 |
| InChIKey | JUWMKKWQGSBTOY-HCBDQACASA-N |
| XLogP | 5.09 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.62 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|