C26H25BrN2O5S2 — CID 131713143
benzhydryl (6R)-7-[(4-bromo-3-oxobutanoyl)amino]-3-(methylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 131713143) has the molecular formula C26H25BrN2O5S2 and a molecular weight of 589.53 g/mol. Its IUPAC name is benzhydryl (6R)-7-[(4-bromo-3-oxobutanoyl)amino]-3-(methylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R)-7-[(4-bromo-3-oxobutanoyl)amino]-3-(methylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 131713143 |
| Molecular Formula | C26H25BrN2O5S2 |
| Molecular Weight | 589.53 g/mol |
| Exact Mass | 588.04 |
| IUPAC Name | benzhydryl (6R)-7-[(4-bromo-3-oxobutanoyl)amino]-3-(methylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CSCC1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)C(NC(=O)CC(=O)CBr)[C@H]2SC1 |
| InChI | InChI=1S/C26H25BrN2O5S2/c1-35-14-18-15-36-25-21(28-20(31)12-19(30)13-27)24(32)29(25)22(18)26(33)34-23(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,21,23,25H,12-15H2,1H3,(H,28,31)/t21?,25-/m1/s1 |
| InChIKey | YQYJVLAHNRSROG-UIDYPRJRSA-N |
| XLogP | 3.69 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|