C33H28N6O6S3 — CID 131723575
benzhydryl (6R,7R)-7-[[(2E)-2-acetyloxyimino-2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-3-(pyridin-4-ylmethylsulfanyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 131723575) has the molecular formula C33H28N6O6S3 and a molecular weight of 700.82 g/mol. Its IUPAC name is benzhydryl (6R,7R)-7-[[(2E)-2-acetyloxyimino-2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-3-(pyridin-4-ylmethylsulfanyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R,7R)-7-[[(2E)-2-acetyloxyimino-2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-3-(pyridin-4-ylmethylsulfanyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 131723575 |
| Molecular Formula | C33H28N6O6S3 |
| Molecular Weight | 700.82 g/mol |
| Exact Mass | 700.12 |
| IUPAC Name | benzhydryl (6R,7R)-7-[[(2E)-2-acetyloxyimino-2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-8-oxo-3-(pyridin-4-ylmethylsulfanyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(=O)O/N=C(/C(=O)N[C@@H]1C(=O)N2C(C(=O)OC(c3ccccc3)c3ccccc3)=C(SCc3ccncc3)CS[C@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C33H28N6O6S3/c1-19(40)45-38-25(23-17-48-33(34)36-23)29(41)37-26-30(42)39-27(24(18-47-31(26)39)46-16-20-12-14-35-15-13-20)32(43)44-28(21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-15,17,26,28,31H,16,18H2,1H3,(H2,34,36)(H,37,41)/b38-25+/t26-,31-/m1/s1 |
| InChIKey | KUCGDCJZCRPOAT-CKWNKRJNSA-N |
| XLogP | 4.27 |
| TPSA | 166.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.82 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|