C34H28N6O9S2 — CID 88720996
benzhydryl (6R)-7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(4-nitrobenzoyl)oxymethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88720996) has the molecular formula C34H28N6O9S2 and a molecular weight of 728.77 g/mol. Its IUPAC name is benzhydryl (6R)-7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(4-nitrobenzoyl)oxymethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R)-7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(4-nitrobenzoyl)oxymethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88720996 |
| Molecular Formula | C34H28N6O9S2 |
| Molecular Weight | 728.77 g/mol |
| Exact Mass | 728.14 |
| IUPAC Name | benzhydryl (6R)-7-[[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(4-nitrobenzoyl)oxymethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CO/N=C(/C(=O)NC1C(=O)N2C(C(=O)OC(c3ccccc3)c3ccccc3)=C(COC(=O)c3ccc([N+](=O)[O-])cc3)CS[C@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C34H28N6O9S2/c1-47-38-25(24-18-51-34(35)36-24)29(41)37-26-30(42)39-27(33(44)49-28(19-8-4-2-5-9-19)20-10-6-3-7-11-20)22(17-50-31(26)39)16-48-32(43)21-12-14-23(15-13-21)40(45)46/h2-15,18,26,28,31H,16-17H2,1H3,(H2,35,36)(H,37,41)/b38-25+/t26?,31-/m1/s1 |
| InChIKey | IREUDKCOHXTLCA-WZKNRLNUSA-N |
| XLogP | 3.83 |
| TPSA | 205.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.77 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|