C16H15BrN6O8S2 — CID 173400727
(6R,7R)-7-[(4-bromo-3-hydroxy-2-nitrosobut-2-enoyl)amino]-3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 173400727) has the molecular formula C16H15BrN6O8S2 and a molecular weight of 563.37 g/mol. Its IUPAC name is (6R,7R)-7-[(4-bromo-3-hydroxy-2-nitrosobut-2-enoyl)amino]-3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-7-[(4-bromo-3-hydroxy-2-nitrosobut-2-enoyl)amino]-3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 173400727 |
| Molecular Formula | C16H15BrN6O8S2 |
| Molecular Weight | 563.37 g/mol |
| Exact Mass | 561.96 |
| IUPAC Name | (6R,7R)-7-[(4-bromo-3-hydroxy-2-nitrosobut-2-enoyl)amino]-3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | Cn1[nH]c(=O)c(=O)nc1SCC1=C(C(=O)O)N2C(=O)[C@@H](NC(=O)C(N=O)=C(O)CBr)[C@H]2SC1 |
| InChI | InChI=1S/C16H15BrN6O8S2/c1-22-16(19-11(26)12(27)20-22)33-4-5-3-32-14-8(13(28)23(14)9(5)15(29)30)18-10(25)7(21-31)6(24)2-17/h8,14,24H,2-4H2,1H3,(H,18,25)(H,20,27)(H,29,30)/t8-,14-/m1/s1 |
| InChIKey | CDDPHMSIJWEOEB-XLKFXECMSA-N |
| XLogP | -0.77 |
| TPSA | 204.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.37 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|