C18H19BrN6O8S2 — CID 91540174
(6R,7R)-7-[(5-bromo-4-methoxyimino-2-oxopentanoyl)amino]-3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 91540174) has the molecular formula C18H19BrN6O8S2 and a molecular weight of 591.42 g/mol. Its IUPAC name is (6R,7R)-7-[(5-bromo-4-methoxyimino-2-oxopentanoyl)amino]-3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-7-[(5-bromo-4-methoxyimino-2-oxopentanoyl)amino]-3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 91540174 |
| Molecular Formula | C18H19BrN6O8S2 |
| Molecular Weight | 591.42 g/mol |
| Exact Mass | 589.99 |
| IUPAC Name | (6R,7R)-7-[(5-bromo-4-methoxyimino-2-oxopentanoyl)amino]-3-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CON=C(CBr)CC(=O)C(=O)N[C@@H]1C(=O)N2C(C(=O)O)=C(CSc3nc(=O)c(=O)[nH]n3C)CS[C@H]12 |
| InChI | InChI=1S/C18H19BrN6O8S2/c1-24-18(21-13(28)14(29)22-24)35-6-7-5-34-16-10(15(30)25(16)11(7)17(31)32)20-12(27)9(26)3-8(4-19)23-33-2/h10,16H,3-6H2,1-2H3,(H,20,27)(H,22,29)(H,31,32)/t10-,16-/m1/s1 |
| InChIKey | NOIIUEHQIRWOGS-QLJPJBMISA-N |
| XLogP | -1.34 |
| TPSA | 193.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.42 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|