C14H18ClN3O7S — CID 173423105
(6R)-7-[(4-chloro-2-methoxyimino-3-oxobutanoyl)amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 173423105) has the molecular formula C14H18ClN3O7S and a molecular weight of 407.83 g/mol. Its IUPAC name is (6R)-7-[(4-chloro-2-methoxyimino-3-oxobutanoyl)amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-7-[(4-chloro-2-methoxyimino-3-oxobutanoyl)amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 173423105 |
| Molecular Formula | C14H18ClN3O7S |
| Molecular Weight | 407.83 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | (6R)-7-[(4-chloro-2-methoxyimino-3-oxobutanoyl)amino]-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | COCC1(C(=O)O)CS[C@@H]2C(NC(=O)C(=NOC)C(=O)CCl)C(=O)N2C1 |
| InChI | InChI=1S/C14H18ClN3O7S/c1-24-5-14(13(22)23)4-18-11(21)9(12(18)26-6-14)16-10(20)8(17-25-2)7(19)3-15/h9,12H,3-6H2,1-2H3,(H,16,20)(H,22,23)/t9?,12-,14?/m1/s1 |
| InChIKey | XXRMDVXKGJVXEP-VTGPFMDVSA-N |
| XLogP | -1.09 |
| TPSA | 134.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.83 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|