C13H15BrN4O8S — CID 173389334
(6R)-7-[(4-bromo-3-hydroxy-2-nitrosobut-2-enoyl)amino]-3-(carbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 173389334) has the molecular formula C13H15BrN4O8S and a molecular weight of 467.25 g/mol. Its IUPAC name is (6R)-7-[(4-bromo-3-hydroxy-2-nitrosobut-2-enoyl)amino]-3-(carbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-7-[(4-bromo-3-hydroxy-2-nitrosobut-2-enoyl)amino]-3-(carbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 173389334 |
| Molecular Formula | C13H15BrN4O8S |
| Molecular Weight | 467.25 g/mol |
| Exact Mass | 465.98 |
| IUPAC Name | (6R)-7-[(4-bromo-3-hydroxy-2-nitrosobut-2-enoyl)amino]-3-(carbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | NC(=O)OCC1(C(=O)O)CS[C@@H]2C(NC(=O)C(N=O)=C(O)CBr)C(=O)N2C1 |
| InChI | InChI=1S/C13H15BrN4O8S/c14-1-5(19)6(17-25)8(20)16-7-9(21)18-2-13(11(22)23,3-26-12(15)24)4-27-10(7)18/h7,10,19H,1-4H2,(H2,15,24)(H,16,20)(H,22,23)/t7?,10-,13?/m1/s1 |
| InChIKey | VAYLWGRNAOETGB-OILJVLCYSA-N |
| XLogP | -0.52 |
| TPSA | 188.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.25 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|