C17H18ClN5O7S2 — CID 173359426
(6R)-7-[[2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-(1-carboxyethoxyimino)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 173359426) has the molecular formula C17H18ClN5O7S2 and a molecular weight of 503.95 g/mol. Its IUPAC name is (6R)-7-[[2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-(1-carboxyethoxyimino)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-7-[[2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-(1-carboxyethoxyimino)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 173359426 |
| Molecular Formula | C17H18ClN5O7S2 |
| Molecular Weight | 503.95 g/mol |
| Exact Mass | 503.03 |
| IUPAC Name | (6R)-7-[[2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-(1-carboxyethoxyimino)acetyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | C=CC1(C(=O)O)CS[C@@H]2C(NC(=O)C(=NOC(C)C(=O)O)c3nc(N)sc3Cl)C(=O)N2C1 |
| InChI | InChI=1S/C17H18ClN5O7S2/c1-3-17(15(28)29)4-23-12(25)9(13(23)31-5-17)20-11(24)8(22-30-6(2)14(26)27)7-10(18)32-16(19)21-7/h3,6,9,13H,1,4-5H2,2H3,(H2,19,21)(H,20,24)(H,26,27)(H,28,29)/t6?,9?,13-,17?/m1/s1 |
| InChIKey | QTRZEWGCOASYRX-VSKVXREKSA-N |
| XLogP | 0.23 |
| TPSA | 184.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.95 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|