C19H22N6O10S2 — CID 173429840
(6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(1-carboxyethoxyimino)acetyl]amino]-8-oxo-3-(3-oxobutanoyloxymethyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 173429840) has the molecular formula C19H22N6O10S2 and a molecular weight of 558.55 g/mol. Its IUPAC name is (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(1-carboxyethoxyimino)acetyl]amino]-8-oxo-3-(3-oxobutanoyloxymethyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(1-carboxyethoxyimino)acetyl]amino]-8-oxo-3-(3-oxobutanoyloxymethyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 173429840 |
| Molecular Formula | C19H22N6O10S2 |
| Molecular Weight | 558.55 g/mol |
| Exact Mass | 558.08 |
| IUPAC Name | (6R)-7-[[2-(5-amino-1,2,4-thiadiazol-3-yl)-2-(1-carboxyethoxyimino)acetyl]amino]-8-oxo-3-(3-oxobutanoyloxymethyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | CC(=O)CC(=O)OCC1(C(=O)O)CS[C@@H]2C(NC(=O)C(=NOC(C)C(=O)O)c3nsc(N)n3)C(=O)N2C1 |
| InChI | InChI=1S/C19H22N6O10S2/c1-7(26)3-9(27)34-5-19(17(32)33)4-25-14(29)11(15(25)36-6-19)21-13(28)10(12-22-18(20)37-24-12)23-35-8(2)16(30)31/h8,11,15H,3-6H2,1-2H3,(H,21,28)(H,30,31)(H,32,33)(H2,20,22,24)/t8?,11?,15-,19?/m1/s1 |
| InChIKey | INXOZEFICAUVMB-HKMHKCGOSA-N |
| XLogP | -1.69 |
| TPSA | 240.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.55 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|