C16H18N4O8S2 — CID 123215997
(2S,3S)-3-[[2-[(1,5-dihydroxy-4-oxo-2-pyridinyl)methoxyamino]-2-thiophen-2-ylethylidene]amino]-2-methyl-4-oxoazetidine-1-sulfonic acid (PubChem CID 123215997) has the molecular formula C16H18N4O8S2 and a molecular weight of 458.47 g/mol. Its IUPAC name is (2S,3S)-3-[[2-[(1,5-dihydroxy-4-oxo-2-pyridinyl)methoxyamino]-2-thiophen-2-ylethylidene]amino]-2-methyl-4-oxoazetidine-1-sulfonic acid.
| Compound Name | (2S,3S)-3-[[2-[(1,5-dihydroxy-4-oxo-2-pyridinyl)methoxyamino]-2-thiophen-2-ylethylidene]amino]-2-methyl-4-oxoazetidine-1-sulfonic acid |
|---|---|
| PubChem CID | 123215997 |
| Molecular Formula | C16H18N4O8S2 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | (2S,3S)-3-[[2-[(1,5-dihydroxy-4-oxo-2-pyridinyl)methoxyamino]-2-thiophen-2-ylethylidene]amino]-2-methyl-4-oxoazetidine-1-sulfonic acid |
| SMILES | C[C@H]1[C@H](/N=C/C(NOCc2cc(=O)c(O)cn2O)c2cccs2)C(=O)N1S(=O)(=O)O |
| InChI | InChI=1S/C16H18N4O8S2/c1-9-15(16(23)20(9)30(25,26)27)17-6-11(14-3-2-4-29-14)18-28-8-10-5-12(21)13(22)7-19(10)24/h2-7,9,11,15,18,22,24H,8H2,1H3,(H,25,26,27)/b17-6+/t9-,11?,15-/m0/s1 |
| InChIKey | AOCKWRLILXSRKD-OOHGVOHXSA-N |
| XLogP | 0.09 |
| TPSA | 170.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|