C18H20O3S — CID 132961938
ethyl (E)-4-(4-hydroxy-3,5-dimethylphenyl)-4-thiophen-2-ylbut-2-enoate (PubChem CID 132961938) has the molecular formula C18H20O3S and a molecular weight of 316.42 g/mol. Its IUPAC name is ethyl (E)-4-(4-hydroxy-3,5-dimethylphenyl)-4-thiophen-2-ylbut-2-enoate.
| Compound Name | ethyl (E)-4-(4-hydroxy-3,5-dimethylphenyl)-4-thiophen-2-ylbut-2-enoate |
|---|---|
| PubChem CID | 132961938 |
| Molecular Formula | C18H20O3S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | ethyl (E)-4-(4-hydroxy-3,5-dimethylphenyl)-4-thiophen-2-ylbut-2-enoate |
| SMILES | CCOC(=O)/C=C/C(c1cc(C)c(O)c(C)c1)c1cccs1 |
| InChI | InChI=1S/C18H20O3S/c1-4-21-17(19)8-7-15(16-6-5-9-22-16)14-10-12(2)18(20)13(3)11-14/h5-11,15,20H,4H2,1-3H3/b8-7+ |
| InChIKey | KWSGWXSILYKEFM-BQYQJAHWSA-N |
| XLogP | 4.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|