C13H15NOS — CID 131297133
4-[(R)-amino(thiophen-2-yl)methyl]-2,6-dimethylphenol (PubChem CID 131297133) has the molecular formula C13H15NOS and a molecular weight of 233.34 g/mol. Its IUPAC name is 4-[(R)-amino(thiophen-2-yl)methyl]-2,6-dimethylphenol.
| Compound Name | 4-[(R)-amino(thiophen-2-yl)methyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 131297133 |
| Molecular Formula | C13H15NOS |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 4-[(R)-amino(thiophen-2-yl)methyl]-2,6-dimethylphenol |
| SMILES | Cc1cc([C@@H](N)c2cccs2)cc(C)c1O |
| InChI | InChI=1S/C13H15NOS/c1-8-6-10(7-9(2)13(8)15)12(14)11-4-3-5-16-11/h3-7,12,15H,14H2,1-2H3/t12-/m1/s1 |
| InChIKey | GSTNBKXYETURER-GFCCVEGCSA-N |
| XLogP | 3.12 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |