C13H14ClNO3S — CID 171258264
3-[(S)-amino(thiophen-2-yl)methyl]-4-hydroxy-5-methylbenzoic acid;hydrochloride (PubChem CID 171258264) has the molecular formula C13H14ClNO3S and a molecular weight of 299.78 g/mol. Its IUPAC name is 3-[(S)-amino(thiophen-2-yl)methyl]-4-hydroxy-5-methylbenzoic acid;hydrochloride.
| Compound Name | 3-[(S)-amino(thiophen-2-yl)methyl]-4-hydroxy-5-methylbenzoic acid;hydrochloride |
|---|---|
| PubChem CID | 171258264 |
| Molecular Formula | C13H14ClNO3S |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 3-[(S)-amino(thiophen-2-yl)methyl]-4-hydroxy-5-methylbenzoic acid;hydrochloride |
| SMILES | Cc1cc(C(=O)O)cc([C@H](N)c2cccs2)c1O.Cl |
| InChI | InChI=1S/C13H13NO3S.ClH/c1-7-5-8(13(16)17)6-9(12(7)15)11(14)10-3-2-4-18-10;/h2-6,11,15H,14H2,1H3,(H,16,17);1H/t11-;/m0./s1 |
| InChIKey | JBSTVOROJKVRJR-MERQFXBCSA-N |
| XLogP | 2.93 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|