C11H10ClI2NOS — CID 171235519
2-[(R)-amino(thiophen-2-yl)methyl]-4,6-diiodophenol;hydrochloride (PubChem CID 171235519) has the molecular formula C11H10ClI2NOS and a molecular weight of 493.54 g/mol. Its IUPAC name is 2-[(R)-amino(thiophen-2-yl)methyl]-4,6-diiodophenol;hydrochloride.
| Compound Name | 2-[(R)-amino(thiophen-2-yl)methyl]-4,6-diiodophenol;hydrochloride |
|---|---|
| PubChem CID | 171235519 |
| Molecular Formula | C11H10ClI2NOS |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 492.83 |
| IUPAC Name | 2-[(R)-amino(thiophen-2-yl)methyl]-4,6-diiodophenol;hydrochloride |
| SMILES | Cl.N[C@@H](c1cccs1)c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C11H9I2NOS.ClH/c12-6-4-7(11(15)8(13)5-6)10(14)9-2-1-3-16-9;/h1-5,10,15H,14H2;1H/t10-;/m1./s1 |
| InChIKey | URYGYHDSLQNJNV-HNCPQSOCSA-N |
| XLogP | 4.13 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|