C11H9I2NOS — CID 171215887
2-[(S)-amino(thiophen-3-yl)methyl]-4,6-diiodophenol (PubChem CID 171215887) has the molecular formula C11H9I2NOS and a molecular weight of 457.07 g/mol. Its IUPAC name is 2-[(S)-amino(thiophen-3-yl)methyl]-4,6-diiodophenol.
| Compound Name | 2-[(S)-amino(thiophen-3-yl)methyl]-4,6-diiodophenol |
|---|---|
| PubChem CID | 171215887 |
| Molecular Formula | C11H9I2NOS |
| Molecular Weight | 457.07 g/mol |
| Exact Mass | 456.85 |
| IUPAC Name | 2-[(S)-amino(thiophen-3-yl)methyl]-4,6-diiodophenol |
| SMILES | N[C@H](c1ccsc1)c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C11H9I2NOS/c12-7-3-8(11(15)9(13)4-7)10(14)6-1-2-16-5-6/h1-5,10,15H,14H2/t10-/m1/s1 |
| InChIKey | ZWEIJYRJDWWUER-SNVBAGLBSA-N |
| XLogP | 3.71 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.07 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|