C12H13ClFNOS — CID 171253754
2-[(R)-amino(thiophen-2-yl)methyl]-6-fluoro-4-methylphenol;hydrochloride (PubChem CID 171253754) has the molecular formula C12H13ClFNOS and a molecular weight of 273.76 g/mol. Its IUPAC name is 2-[(R)-amino(thiophen-2-yl)methyl]-6-fluoro-4-methylphenol;hydrochloride.
| Compound Name | 2-[(R)-amino(thiophen-2-yl)methyl]-6-fluoro-4-methylphenol;hydrochloride |
|---|---|
| PubChem CID | 171253754 |
| Molecular Formula | C12H13ClFNOS |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 2-[(R)-amino(thiophen-2-yl)methyl]-6-fluoro-4-methylphenol;hydrochloride |
| SMILES | Cc1cc(F)c(O)c([C@@H](N)c2cccs2)c1.Cl |
| InChI | InChI=1S/C12H12FNOS.ClH/c1-7-5-8(12(15)9(13)6-7)11(14)10-3-2-4-16-10;/h2-6,11,15H,14H2,1H3;1H/t11-;/m1./s1 |
| InChIKey | LYODHJNWKXCHTB-RFVHGSKJSA-N |
| XLogP | 3.37 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|