C11H10ClF2NS — CID 171218565
(R)-(2,4-difluorophenyl)-thiophen-2-ylmethanamine;hydrochloride (PubChem CID 171218565) has the molecular formula C11H10ClF2NS and a molecular weight of 261.72 g/mol. Its IUPAC name is (R)-(2,4-difluorophenyl)-thiophen-2-ylmethanamine;hydrochloride.
| Compound Name | (R)-(2,4-difluorophenyl)-thiophen-2-ylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 171218565 |
| Molecular Formula | C11H10ClF2NS |
| Molecular Weight | 261.72 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | (R)-(2,4-difluorophenyl)-thiophen-2-ylmethanamine;hydrochloride |
| SMILES | Cl.N[C@@H](c1cccs1)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H9F2NS.ClH/c12-7-3-4-8(9(13)6-7)11(14)10-2-1-5-15-10;/h1-6,11H,14H2;1H/t11-;/m1./s1 |
| InChIKey | GGUABAOKHDHCRU-RFVHGSKJSA-N |
| XLogP | 3.50 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.72 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |