C11H9ClF3NS — CID 171205796
(S)-thiophen-2-yl-(2,3,4-trifluorophenyl)methanamine;hydrochloride (PubChem CID 171205796) has the molecular formula C11H9ClF3NS and a molecular weight of 279.71 g/mol. Its IUPAC name is (S)-thiophen-2-yl-(2,3,4-trifluorophenyl)methanamine;hydrochloride.
| Compound Name | (S)-thiophen-2-yl-(2,3,4-trifluorophenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171205796 |
| Molecular Formula | C11H9ClF3NS |
| Molecular Weight | 279.71 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | (S)-thiophen-2-yl-(2,3,4-trifluorophenyl)methanamine;hydrochloride |
| SMILES | Cl.N[C@H](c1cccs1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H8F3NS.ClH/c12-7-4-3-6(9(13)10(7)14)11(15)8-2-1-5-16-8;/h1-5,11H,15H2;1H/t11-;/m0./s1 |
| InChIKey | ROIMAVLTBXGTJH-MERQFXBCSA-N |
| XLogP | 3.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.71 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|