C11H9F2NS — CID 94532686
(R)-(2,3-difluorophenyl)-thiophen-2-ylmethanamine (PubChem CID 94532686) has the molecular formula C11H9F2NS and a molecular weight of 225.26 g/mol. Its IUPAC name is (R)-(2,3-difluorophenyl)-thiophen-2-ylmethanamine.
| Compound Name | (R)-(2,3-difluorophenyl)-thiophen-2-ylmethanamine |
|---|---|
| PubChem CID | 94532686 |
| Molecular Formula | C11H9F2NS |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | (R)-(2,3-difluorophenyl)-thiophen-2-ylmethanamine |
| SMILES | N[C@@H](c1cccs1)c1cccc(F)c1F |
| InChI | InChI=1S/C11H9F2NS/c12-8-4-1-3-7(10(8)13)11(14)9-5-2-6-15-9/h1-6,11H,14H2/t11-/m1/s1 |
| InChIKey | PENOBDJHJGZTAD-LLVKDONJSA-N |
| XLogP | 3.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |