C13H10BrF2N — CID 63989436
(2-bromophenyl)-(2,3-difluorophenyl)methanamine (PubChem CID 63989436) has the molecular formula C13H10BrF2N and a molecular weight of 298.13 g/mol. Its IUPAC name is (2-bromophenyl)-(2,3-difluorophenyl)methanamine.
| Compound Name | (2-bromophenyl)-(2,3-difluorophenyl)methanamine |
|---|---|
| PubChem CID | 63989436 |
| Molecular Formula | C13H10BrF2N |
| Molecular Weight | 298.13 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | (2-bromophenyl)-(2,3-difluorophenyl)methanamine |
| SMILES | NC(c1ccccc1Br)c1cccc(F)c1F |
| InChI | InChI=1S/C13H10BrF2N/c14-10-6-2-1-4-8(10)13(17)9-5-3-7-11(15)12(9)16/h1-7,13H,17H2 |
| InChIKey | FVLFEXRNSGJVGO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.13 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |